C13H7Cl2N5 — CID 78595972
3-amino-5-[1-cyano-2-(2,4-dichlorophenyl)ethenyl]-1H-pyrazole-4-carbonitrile (PubChem CID 78595972) has the molecular formula C13H7Cl2N5 and a molecular weight of 304.14 g/mol. Its IUPAC name is 3-amino-5-[1-cyano-2-(2,4-dichlorophenyl)ethenyl]-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-amino-5-[1-cyano-2-(2,4-dichlorophenyl)ethenyl]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 78595972 |
| Molecular Formula | C13H7Cl2N5 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 3-amino-5-[1-cyano-2-(2,4-dichlorophenyl)ethenyl]-1H-pyrazole-4-carbonitrile |
| SMILES | N#CC(=Cc1ccc(Cl)cc1Cl)c1[nH]nc(N)c1C#N |
| InChI | InChI=1S/C13H7Cl2N5/c14-9-2-1-7(11(15)4-9)3-8(5-16)12-10(6-17)13(18)20-19-12/h1-4H,(H3,18,19,20) |
| InChIKey | ZLMYRPFHYMSOAF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|