C28H15Cl4N5 — CID 161083745
2-amino-4-(2,4-dichlorophenyl)-6-phenylpyridine-3-carbonitrile;2-[(2,4-dichlorophenyl)methylidene]propanedinitrile (PubChem CID 161083745) has the molecular formula C28H15Cl4N5 and a molecular weight of 563.28 g/mol. Its IUPAC name is 2-amino-4-(2,4-dichlorophenyl)-6-phenylpyridine-3-carbonitrile;2-[(2,4-dichlorophenyl)methylidene]propanedinitrile.
| Compound Name | 2-amino-4-(2,4-dichlorophenyl)-6-phenylpyridine-3-carbonitrile;2-[(2,4-dichlorophenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 161083745 |
| Molecular Formula | C28H15Cl4N5 |
| Molecular Weight | 563.28 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | 2-amino-4-(2,4-dichlorophenyl)-6-phenylpyridine-3-carbonitrile;2-[(2,4-dichlorophenyl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(Cl)cc1Cl.N#Cc1c(-c2ccc(Cl)cc2Cl)cc(-c2ccccc2)nc1N |
| InChI | InChI=1S/C18H11Cl2N3.C10H4Cl2N2/c19-12-6-7-13(16(20)8-12)14-9-17(11-4-2-1-3-5-11)23-18(22)15(14)10-21;11-9-2-1-8(10(12)4-9)3-7(5-13)6-14/h1-9H,(H2,22,23);1-4H |
| InChIKey | UGFVVTVGYYIDSF-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.28 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|