C8H4Cl2F2 — CID 101499085
2,4-dichloro-1-(2,2-difluoroethenyl)benzene (PubChem CID 101499085) has the molecular formula C8H4Cl2F2 and a molecular weight of 209.02 g/mol. Its IUPAC name is 2,4-dichloro-1-(2,2-difluoroethenyl)benzene.
| Compound Name | 2,4-dichloro-1-(2,2-difluoroethenyl)benzene |
|---|---|
| PubChem CID | 101499085 |
| Molecular Formula | C8H4Cl2F2 |
| Molecular Weight | 209.02 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | 2,4-dichloro-1-(2,2-difluoroethenyl)benzene |
| SMILES | FC(F)=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H4Cl2F2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-4H |
| InChIKey | XZHPDXMVLNDOQR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |