C16H11Cl3O2 — CID 58952572
methyl (E)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 58952572) has the molecular formula C16H11Cl3O2 and a molecular weight of 341.62 g/mol. Its IUPAC name is methyl (E)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | methyl (E)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58952572 |
| Molecular Formula | C16H11Cl3O2 |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | methyl (E)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3O2/c1-21-16(20)14(10-2-5-12(17)6-3-10)8-11-4-7-13(18)9-15(11)19/h2-9H,1H3/b14-8+ |
| InChIKey | PUILSJQUKLCZCX-RIYZIHGNSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|