C12H13Cl2NO2 — CID 127255917
methyl (E)-2-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-enoate (PubChem CID 127255917) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is methyl (E)-2-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-enoate.
| Compound Name | methyl (E)-2-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 127255917 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | methyl (E)-2-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-enoate |
| SMILES | COC(=O)/C(=C/N(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO2/c1-15(2)7-10(12(16)17-3)9-5-4-8(13)6-11(9)14/h4-7H,1-3H3/b10-7+ |
| InChIKey | YEOQGAYSULFKNP-JXMROGBWSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|