C17H21Cl2N3O5 — CID 137368673
ethyl N-[(E)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-N-(ethoxycarbonylamino)carbamate (PubChem CID 137368673) has the molecular formula C17H21Cl2N3O5 and a molecular weight of 418.28 g/mol. Its IUPAC name is ethyl N-[(E)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-N-(ethoxycarbonylamino)carbamate.
| Compound Name | ethyl N-[(E)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-N-(ethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 137368673 |
| Molecular Formula | C17H21Cl2N3O5 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | ethyl N-[(E)-3-(2,4-dichlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-N-(ethoxycarbonylamino)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)/C(=C/N(C)C)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3O5/c1-5-26-16(24)20-22(17(25)27-6-2)14(10-21(3)4)15(23)12-8-7-11(18)9-13(12)19/h7-10H,5-6H2,1-4H3,(H,20,24)/b14-10+ |
| InChIKey | ZOOLCWGMVISTLG-GXDHUFHOSA-N |
| XLogP | 3.70 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|