C14H16Cl2N2O4 — CID 91326678
ethyl N-[[1-(2,4-dichlorophenyl)-3-ethoxy-1-oxopropan-2-ylidene]amino]carbamate (PubChem CID 91326678) has the molecular formula C14H16Cl2N2O4 and a molecular weight of 347.20 g/mol. Its IUPAC name is ethyl N-[[1-(2,4-dichlorophenyl)-3-ethoxy-1-oxopropan-2-ylidene]amino]carbamate.
| Compound Name | ethyl N-[[1-(2,4-dichlorophenyl)-3-ethoxy-1-oxopropan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 91326678 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | ethyl N-[[1-(2,4-dichlorophenyl)-3-ethoxy-1-oxopropan-2-ylidene]amino]carbamate |
| SMILES | CCOCC(=NNC(=O)OCC)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O4/c1-3-21-8-12(17-18-14(20)22-4-2)13(19)10-6-5-9(15)7-11(10)16/h5-7H,3-4,8H2,1-2H3,(H,18,20) |
| InChIKey | KLYBDEGVAUUZSW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|