C19H21ClN2O2S — CID 11810927
ethyl N-[(E)-[(4-chlorophenyl)-[4-(ethylsulfanylmethyl)phenyl]methylidene]amino]carbamate (PubChem CID 11810927) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is ethyl N-[(E)-[(4-chlorophenyl)-[4-(ethylsulfanylmethyl)phenyl]methylidene]amino]carbamate.
| Compound Name | ethyl N-[(E)-[(4-chlorophenyl)-[4-(ethylsulfanylmethyl)phenyl]methylidene]amino]carbamate |
|---|---|
| PubChem CID | 11810927 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | ethyl N-[(E)-[(4-chlorophenyl)-[4-(ethylsulfanylmethyl)phenyl]methylidene]amino]carbamate |
| SMILES | CCOC(=O)N/N=C(/c1ccc(Cl)cc1)c1ccc(CSCC)cc1 |
| InChI | InChI=1S/C19H21ClN2O2S/c1-3-24-19(23)22-21-18(16-9-11-17(20)12-10-16)15-7-5-14(6-8-15)13-25-4-2/h5-12H,3-4,13H2,1-2H3,(H,22,23)/b21-18+ |
| InChIKey | NUSQKONJODBYPO-DYTRJAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|