C15H14Cl2N2O2S2 — CID 139842855
chloromethyl N-[[(4-chlorophenyl)-[5-(methylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate (PubChem CID 139842855) has the molecular formula C15H14Cl2N2O2S2 and a molecular weight of 389.33 g/mol. Its IUPAC name is chloromethyl N-[[(4-chlorophenyl)-[5-(methylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate.
| Compound Name | chloromethyl N-[[(4-chlorophenyl)-[5-(methylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate |
|---|---|
| PubChem CID | 139842855 |
| Molecular Formula | C15H14Cl2N2O2S2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | chloromethyl N-[[(4-chlorophenyl)-[5-(methylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate |
| SMILES | CSCc1ccc(C(=NNC(=O)OCCl)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C15H14Cl2N2O2S2/c1-22-8-12-6-7-13(23-12)14(18-19-15(20)21-9-16)10-2-4-11(17)5-3-10/h2-7H,8-9H2,1H3,(H,19,20) |
| InChIKey | LQTMXRQQOZUPQI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|