C17H19ClN2O2S2 — CID 139842844
ethyl N-[[(4-chlorophenyl)-[5-(ethylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate (PubChem CID 139842844) has the molecular formula C17H19ClN2O2S2 and a molecular weight of 382.94 g/mol. Its IUPAC name is ethyl N-[[(4-chlorophenyl)-[5-(ethylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate.
| Compound Name | ethyl N-[[(4-chlorophenyl)-[5-(ethylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate |
|---|---|
| PubChem CID | 139842844 |
| Molecular Formula | C17H19ClN2O2S2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | ethyl N-[[(4-chlorophenyl)-[5-(ethylsulfanylmethyl)thiophen-2-yl]methylidene]amino]carbamate |
| SMILES | CCOC(=O)NN=C(c1ccc(Cl)cc1)c1ccc(CSCC)s1 |
| InChI | InChI=1S/C17H19ClN2O2S2/c1-3-22-17(21)20-19-16(12-5-7-13(18)8-6-12)15-10-9-14(24-15)11-23-4-2/h5-10H,3-4,11H2,1-2H3,(H,20,21) |
| InChIKey | YZIVNTJOXPRABJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|