C15H16ClN3O3S2 — CID 139842839
1-[[(4-chlorophenyl)-[5-(methylsulfonylmethyl)thiophen-2-yl]methylidene]amino]-3-methylurea (PubChem CID 139842839) has the molecular formula C15H16ClN3O3S2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-[[(4-chlorophenyl)-[5-(methylsulfonylmethyl)thiophen-2-yl]methylidene]amino]-3-methylurea.
| Compound Name | 1-[[(4-chlorophenyl)-[5-(methylsulfonylmethyl)thiophen-2-yl]methylidene]amino]-3-methylurea |
|---|---|
| PubChem CID | 139842839 |
| Molecular Formula | C15H16ClN3O3S2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1-[[(4-chlorophenyl)-[5-(methylsulfonylmethyl)thiophen-2-yl]methylidene]amino]-3-methylurea |
| SMILES | CNC(=O)NN=C(c1ccc(Cl)cc1)c1ccc(CS(C)(=O)=O)s1 |
| InChI | InChI=1S/C15H16ClN3O3S2/c1-17-15(20)19-18-14(10-3-5-11(16)6-4-10)13-8-7-12(23-13)9-24(2,21)22/h3-8H,9H2,1-2H3,(H2,17,19,20) |
| InChIKey | JYBOPCLGRWINKL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|