C16H15ClN2O4S — CID 9442397
N'-(4-chlorobenzoyl)-4-(methylsulfonylmethyl)benzohydrazide (PubChem CID 9442397) has the molecular formula C16H15ClN2O4S and a molecular weight of 366.83 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-4-(methylsulfonylmethyl)benzohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-4-(methylsulfonylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 9442397 |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N'-(4-chlorobenzoyl)-4-(methylsulfonylmethyl)benzohydrazide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)NNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H15ClN2O4S/c1-24(22,23)10-11-2-4-12(5-3-11)15(20)18-19-16(21)13-6-8-14(17)9-7-13/h2-9H,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | XJJGRXDTNOIPNL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|