C16H18N2O5S — CID 9468106
2,5-dimethyl-N'-[4-(methylsulfonylmethyl)benzoyl]furan-3-carbohydrazide (PubChem CID 9468106) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[4-(methylsulfonylmethyl)benzoyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[4-(methylsulfonylmethyl)benzoyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 9468106 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2,5-dimethyl-N'-[4-(methylsulfonylmethyl)benzoyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(CS(C)(=O)=O)cc2)c(C)o1 |
| InChI | InChI=1S/C16H18N2O5S/c1-10-8-14(11(2)23-10)16(20)18-17-15(19)13-6-4-12(5-7-13)9-24(3,21)22/h4-8H,9H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | JPONGMPUVPUJBX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|