C14H14ClN3O5S — CID 4845850
2-chloro-5-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 4845850) has the molecular formula C14H14ClN3O5S and a molecular weight of 371.80 g/mol. Its IUPAC name is 2-chloro-5-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4845850 |
| Molecular Formula | C14H14ClN3O5S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2-chloro-5-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c(C)o1 |
| InChI | InChI=1S/C14H14ClN3O5S/c1-7-5-10(8(2)23-7)14(20)18-17-13(19)9-3-4-11(15)12(6-9)24(16,21)22/h3-6H,1-2H3,(H,17,19)(H,18,20)(H2,16,21,22) |
| InChIKey | JYUDJFKIMDOKTH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|