C16H18ClN3O5S — CID 26895477
4-chloro-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 26895477) has the molecular formula C16H18ClN3O5S and a molecular weight of 399.86 g/mol. Its IUPAC name is 4-chloro-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 26895477 |
| Molecular Formula | C16H18ClN3O5S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-chloro-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(S(=O)(=O)N(C)C)ccc2Cl)c(C)o1 |
| InChI | InChI=1S/C16H18ClN3O5S/c1-9-7-12(10(2)25-9)15(21)18-19-16(22)13-8-11(5-6-14(13)17)26(23,24)20(3)4/h5-8H,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | PJLAVRWNKXJADK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|