C15H15ClN2O5S — CID 31289347
N'-(2-chloro-5-methylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 31289347) has the molecular formula C15H15ClN2O5S and a molecular weight of 370.81 g/mol. Its IUPAC name is N'-(2-chloro-5-methylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(2-chloro-5-methylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 31289347 |
| Molecular Formula | C15H15ClN2O5S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N'-(2-chloro-5-methylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(S(C)(=O)=O)ccc2Cl)c(C)o1 |
| InChI | InChI=1S/C15H15ClN2O5S/c1-8-6-11(9(2)23-8)14(19)17-18-15(20)12-7-10(24(3,21)22)4-5-13(12)16/h4-7H,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | BDTPCUOVSIGJMD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|