C15H14ClNO3S — CID 7899858
2-chloro-N-(4-methylphenyl)-5-methylsulfonylbenzamide (PubChem CID 7899858) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is 2-chloro-N-(4-methylphenyl)-5-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(4-methylphenyl)-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 7899858 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-chloro-N-(4-methylphenyl)-5-methylsulfonylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(S(C)(=O)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO3S/c1-10-3-5-11(6-4-10)17-15(18)13-9-12(21(2,19)20)7-8-14(13)16/h3-9H,1-2H3,(H,17,18) |
| InChIKey | XOFSIMOHCCDGAN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |