C14H12ClNO3S2 — CID 107021766
2-chloro-N-(4-methylsulfonylphenyl)-5-sulfanylbenzamide (PubChem CID 107021766) has the molecular formula C14H12ClNO3S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-chloro-N-(4-methylsulfonylphenyl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(4-methylsulfonylphenyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107021766 |
| Molecular Formula | C14H12ClNO3S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-chloro-N-(4-methylsulfonylphenyl)-5-sulfanylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2cc(S)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H12ClNO3S2/c1-21(18,19)11-5-2-9(3-6-11)16-14(17)12-8-10(20)4-7-13(12)15/h2-8,20H,1H3,(H,16,17) |
| InChIKey | JPYCVTOCQOGIIP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|