C9H13Cl2N3O3S — CID 174942395
2-chloro-5-(dimethylaminocarbamoyl)benzenesulfonamide;hydrochloride (PubChem CID 174942395) has the molecular formula C9H13Cl2N3O3S and a molecular weight of 314.19 g/mol. Its IUPAC name is 2-chloro-5-(dimethylaminocarbamoyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-chloro-5-(dimethylaminocarbamoyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 174942395 |
| Molecular Formula | C9H13Cl2N3O3S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-chloro-5-(dimethylaminocarbamoyl)benzenesulfonamide;hydrochloride |
| SMILES | CN(C)NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1.Cl |
| InChI | InChI=1S/C9H12ClN3O3S.ClH/c1-13(2)12-9(14)6-3-4-7(10)8(5-6)17(11,15)16;/h3-5H,1-2H3,(H,12,14)(H2,11,15,16);1H |
| InChIKey | REZFARSQQHXINZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|