C9H12ClN3O — CID 83012713
3-amino-4-chloro-N',N'-dimethylbenzohydrazide (PubChem CID 83012713) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is 3-amino-4-chloro-N',N'-dimethylbenzohydrazide.
| Compound Name | 3-amino-4-chloro-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 83012713 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 3-amino-4-chloro-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)NC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C9H12ClN3O/c1-13(2)12-9(14)6-3-4-7(10)8(11)5-6/h3-5H,11H2,1-2H3,(H,12,14) |
| InChIKey | HPTOOERYRPNYQU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|