C11H15ClN2O4S — CID 70598414
4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-3-sulfamoylbenzamide (PubChem CID 70598414) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is 4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 70598414 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-3-sulfamoylbenzamide |
| SMILES | CC(C)(CO)NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H15ClN2O4S/c1-11(2,6-15)14-10(16)7-3-4-8(12)9(5-7)19(13,17)18/h3-5,15H,6H2,1-2H3,(H,14,16)(H2,13,17,18) |
| InChIKey | KLDMNDIBGWYUMK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |