C13H16ClNO5S — CID 64670702
3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-methylbutanoic acid (PubChem CID 64670702) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is 3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-methylbutanoic acid.
| Compound Name | 3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 64670702 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-[(4-chloro-3-methylsulfonylbenzoyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H16ClNO5S/c1-13(2,7-11(16)17)15-12(18)8-4-5-9(14)10(6-8)21(3,19)20/h4-6H,7H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | VDLDAKIQIAVLNE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |