C12H17NO3 — CID 103957694
4-hydroxy-N-(1-hydroxy-2-methylpropan-2-yl)-3-methylbenzamide (PubChem CID 103957694) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-hydroxy-N-(1-hydroxy-2-methylpropan-2-yl)-3-methylbenzamide.
| Compound Name | 4-hydroxy-N-(1-hydroxy-2-methylpropan-2-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 103957694 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-hydroxy-N-(1-hydroxy-2-methylpropan-2-yl)-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC(C)(C)CO)ccc1O |
| InChI | InChI=1S/C12H17NO3/c1-8-6-9(4-5-10(8)15)11(16)13-12(2,3)7-14/h4-6,14-15H,7H2,1-3H3,(H,13,16) |
| InChIKey | KCALRLRBEAIDLJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |