C16H18ClN3O5S2 — CID 24635521
4-chloro-N-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-sulfamoylbenzamide (PubChem CID 24635521) has the molecular formula C16H18ClN3O5S2 and a molecular weight of 431.92 g/mol. Its IUPAC name is 4-chloro-N-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 24635521 |
| Molecular Formula | C16H18ClN3O5S2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 4-chloro-N-[3-(dimethylsulfamoyl)-4-methylphenyl]-3-sulfamoylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H18ClN3O5S2/c1-10-4-6-12(9-14(10)27(24,25)20(2)3)19-16(21)11-5-7-13(17)15(8-11)26(18,22)23/h4-9H,1-3H3,(H,19,21)(H2,18,22,23) |
| InChIKey | ZHUPNBNTIKKAOZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |