C18H20FN3O5S — CID 55597383
N'-(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 55597383) has the molecular formula C18H20FN3O5S and a molecular weight of 409.44 g/mol. Its IUPAC name is N'-(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 55597383 |
| Molecular Formula | C18H20FN3O5S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N'-(4-fluoro-3-pyrrolidin-1-ylsulfonylbenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(F)c(S(=O)(=O)N3CCCC3)c2)c(C)o1 |
| InChI | InChI=1S/C18H20FN3O5S/c1-11-9-14(12(2)27-11)18(24)21-20-17(23)13-5-6-15(19)16(10-13)28(25,26)22-7-3-4-8-22/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | SJMJIGQRZKQDOB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|