C21H20N4O4 — CID 34999919
1-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-phenylurea (PubChem CID 34999919) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 34999919 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[4-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]phenyl]-3-phenylurea |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)c(C)o1 |
| InChI | InChI=1S/C21H20N4O4/c1-13-12-18(14(2)29-13)20(27)25-24-19(26)15-8-10-17(11-9-15)23-21(28)22-16-6-4-3-5-7-16/h3-12H,1-2H3,(H,24,26)(H,25,27)(H2,22,23,28) |
| InChIKey | IMTVLCHYZHMWGA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|