C22H21N3O5 — CID 55619007
methyl 2-methyl-5-[[[4-(phenylcarbamoylamino)benzoyl]amino]methyl]furan-3-carboxylate (PubChem CID 55619007) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl 2-methyl-5-[[[4-(phenylcarbamoylamino)benzoyl]amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[[4-(phenylcarbamoylamino)benzoyl]amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 55619007 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl 2-methyl-5-[[[4-(phenylcarbamoylamino)benzoyl]amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)oc1C |
| InChI | InChI=1S/C22H21N3O5/c1-14-19(21(27)29-2)12-18(30-14)13-23-20(26)15-8-10-17(11-9-15)25-22(28)24-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H,23,26)(H2,24,25,28) |
| InChIKey | NMMSTSQXYZBZIG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |