C17H15N3O5 — CID 124504957
methyl 2-methyl-5-[[(4-oxo-3H-phthalazine-1-carbonyl)amino]methyl]furan-3-carboxylate (PubChem CID 124504957) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is methyl 2-methyl-5-[[(4-oxo-3H-phthalazine-1-carbonyl)amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[(4-oxo-3H-phthalazine-1-carbonyl)amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 124504957 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | methyl 2-methyl-5-[[(4-oxo-3H-phthalazine-1-carbonyl)amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC(=O)c2n[nH]c(=O)c3ccccc23)oc1C |
| InChI | InChI=1S/C17H15N3O5/c1-9-13(17(23)24-2)7-10(25-9)8-18-16(22)14-11-5-3-4-6-12(11)15(21)20-19-14/h3-7H,8H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | QGYUNQJOXPRTNN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |