C17H17N3O4 — CID 78866428
methyl 2-methyl-5-[[(5-methyl-1H-indazole-3-carbonyl)amino]methyl]furan-3-carboxylate (PubChem CID 78866428) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is methyl 2-methyl-5-[[(5-methyl-1H-indazole-3-carbonyl)amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[(5-methyl-1H-indazole-3-carbonyl)amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 78866428 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | methyl 2-methyl-5-[[(5-methyl-1H-indazole-3-carbonyl)amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC(=O)c2n[nH]c3ccc(C)cc23)oc1C |
| InChI | InChI=1S/C17H17N3O4/c1-9-4-5-14-13(6-9)15(20-19-14)16(21)18-8-11-7-12(10(2)24-11)17(22)23-3/h4-7H,8H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | NWKFINBFEYHMIO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |