C17H19N3O3 — CID 2594236
N-[3-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]ethenyl]phenyl]acetamide (PubChem CID 2594236) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[3-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]ethenyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2594236 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[3-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]ethenyl]phenyl]acetamide |
| SMILES | C=C(NNC(=O)c1cc(C)oc1C)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-10-8-16(12(3)23-10)17(22)20-19-11(2)14-6-5-7-15(9-14)18-13(4)21/h5-9,19H,2H2,1,3-4H3,(H,18,21)(H,20,22) |
| InChIKey | KKGYYJZBKGUOLZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|