C23H19NO4 — CID 38088094
methyl 3-[2-[3-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl]ethynyl]benzoate (PubChem CID 38088094) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 3-[2-[3-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 38088094 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl 3-[2-[3-[(2,5-dimethylfuran-3-carbonyl)amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)c3cc(C)oc3C)c2)c1 |
| InChI | InChI=1S/C23H19NO4/c1-15-12-21(16(2)28-15)22(25)24-20-9-5-7-18(14-20)11-10-17-6-4-8-19(13-17)23(26)27-3/h4-9,12-14H,1-3H3,(H,24,25) |
| InChIKey | KDPKDRZJNQVDOQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|