C17H16FN3O2 — CID 2690799
N-[3-[1-[2-(4-fluorobenzoyl)hydrazinyl]ethenyl]phenyl]acetamide (PubChem CID 2690799) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is N-[3-[1-[2-(4-fluorobenzoyl)hydrazinyl]ethenyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[2-(4-fluorobenzoyl)hydrazinyl]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2690799 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[3-[1-[2-(4-fluorobenzoyl)hydrazinyl]ethenyl]phenyl]acetamide |
| SMILES | C=C(NNC(=O)c1ccc(F)cc1)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C17H16FN3O2/c1-11(14-4-3-5-16(10-14)19-12(2)22)20-21-17(23)13-6-8-15(18)9-7-13/h3-10,20H,1H2,2H3,(H,19,22)(H,21,23) |
| InChIKey | YQIHQYZEBVXAOG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|