C21H17Cl2NO4S — CID 26250465
N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 26250465) has the molecular formula C21H17Cl2NO4S and a molecular weight of 450.34 g/mol. Its IUPAC name is N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 26250465 |
| Molecular Formula | C21H17Cl2NO4S |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2cc(Cl)ccc2Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H17Cl2NO4S/c1-29(26,27)13-14-2-4-15(5-3-14)21(25)24-19-12-17(23)8-11-20(19)28-18-9-6-16(22)7-10-18/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | JCBZJDDKRUCJBX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |