C24H22ClN3O5S — CID 56501680
N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide (PubChem CID 56501680) has the molecular formula C24H22ClN3O5S and a molecular weight of 499.98 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide.
| Compound Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 56501680 |
| Molecular Formula | C24H22ClN3O5S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide |
| SMILES | CCOc1ccc(Oc2ccc(Cl)cc2NC(=O)c2ccc(S(=O)(=O)NCCC#N)cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O5S/c1-2-32-19-7-9-20(10-8-19)33-23-13-6-18(25)16-22(23)28-24(29)17-4-11-21(12-5-17)34(30,31)27-15-3-14-26/h4-13,16,27H,2-3,15H2,1H3,(H,28,29) |
| InChIKey | NQNSQTBHSSQVRO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|