C17H17N3O4S — CID 46529163
4-(2-cyanoethylsulfamoyl)-N-(2-hydroxy-4-methylphenyl)benzamide (PubChem CID 46529163) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-(2-hydroxy-4-methylphenyl)benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-(2-hydroxy-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 46529163 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-(2-hydroxy-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(S(=O)(=O)NCCC#N)cc2)c(O)c1 |
| InChI | InChI=1S/C17H17N3O4S/c1-12-3-8-15(16(21)11-12)20-17(22)13-4-6-14(7-5-13)25(23,24)19-10-2-9-18/h3-8,11,19,21H,2,10H2,1H3,(H,20,22) |
| InChIKey | HZZXSVYKVXKRID-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|