C18H16N4O4S — CID 34304039
4-(2-cyanoethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 34304039) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 34304039 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | Cc1nc2cc(NC(=O)c3ccc(S(=O)(=O)NCCC#N)cc3)ccc2o1 |
| InChI | InChI=1S/C18H16N4O4S/c1-12-21-16-11-14(5-8-17(16)26-12)22-18(23)13-3-6-15(7-4-13)27(24,25)20-10-2-9-19/h3-8,11,20H,2,10H2,1H3,(H,22,23) |
| InChIKey | WMVYLPWKVJHXGK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|