C16H12ClF3N2O4S — CID 134121609
[4-[(Z)-C-(4-chlorophenyl)-N-[(2,2,2-trifluoroacetyl)amino]carbonimidoyl]phenyl] methanesulfonate (PubChem CID 134121609) has the molecular formula C16H12ClF3N2O4S and a molecular weight of 420.80 g/mol. Its IUPAC name is [4-[(Z)-C-(4-chlorophenyl)-N-[(2,2,2-trifluoroacetyl)amino]carbonimidoyl]phenyl] methanesulfonate.
| Compound Name | [4-[(Z)-C-(4-chlorophenyl)-N-[(2,2,2-trifluoroacetyl)amino]carbonimidoyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 134121609 |
| Molecular Formula | C16H12ClF3N2O4S |
| Molecular Weight | 420.80 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | [4-[(Z)-C-(4-chlorophenyl)-N-[(2,2,2-trifluoroacetyl)amino]carbonimidoyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(/C(=N/NC(=O)C(F)(F)F)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H12ClF3N2O4S/c1-27(24,25)26-13-8-4-11(5-9-13)14(10-2-6-12(17)7-3-10)21-22-15(23)16(18,19)20/h2-9H,1H3,(H,22,23)/b21-14+ |
| InChIKey | CPIUXXPSAFQWRW-KGENOOAVSA-N |
| XLogP | 3.11 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|