C19H18ClN3O5S — CID 54458381
[4-[C-(4-chlorophenyl)-N-[cyanomethyl(ethoxycarbonyl)amino]carbonimidoyl]phenyl] methanesulfonate (PubChem CID 54458381) has the molecular formula C19H18ClN3O5S and a molecular weight of 435.89 g/mol. Its IUPAC name is [4-[C-(4-chlorophenyl)-N-[cyanomethyl(ethoxycarbonyl)amino]carbonimidoyl]phenyl] methanesulfonate.
| Compound Name | [4-[C-(4-chlorophenyl)-N-[cyanomethyl(ethoxycarbonyl)amino]carbonimidoyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 54458381 |
| Molecular Formula | C19H18ClN3O5S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | [4-[C-(4-chlorophenyl)-N-[cyanomethyl(ethoxycarbonyl)amino]carbonimidoyl]phenyl] methanesulfonate |
| SMILES | CCOC(=O)N(CC#N)N=C(c1ccc(Cl)cc1)c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H18ClN3O5S/c1-3-27-19(24)23(13-12-21)22-18(14-4-8-16(20)9-5-14)15-6-10-17(11-7-15)28-29(2,25)26/h4-11H,3,13H2,1-2H3 |
| InChIKey | WZVHPWGDBZYMQB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 109.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|