C19H18ClF3N2O5S — CID 54107050
[4-[N-[acetyl(ethoxymethyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate (PubChem CID 54107050) has the molecular formula C19H18ClF3N2O5S and a molecular weight of 478.88 g/mol. Its IUPAC name is [4-[N-[acetyl(ethoxymethyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[N-[acetyl(ethoxymethyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54107050 |
| Molecular Formula | C19H18ClF3N2O5S |
| Molecular Weight | 478.88 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | [4-[N-[acetyl(ethoxymethyl)amino]-C-(4-chlorophenyl)carbonimidoyl]phenyl] trifluoromethanesulfonate |
| SMILES | CCOCN(N=C(c1ccc(Cl)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1)C(C)=O |
| InChI | InChI=1S/C19H18ClF3N2O5S/c1-3-29-12-25(13(2)26)24-18(14-4-8-16(20)9-5-14)15-6-10-17(11-7-15)30-31(27,28)19(21,22)23/h4-11H,3,12H2,1-2H3 |
| InChIKey | NELZLXPPOGEMBN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|