C20H21ClN2O5S — CID 54559039
[4-[C-(4-chlorophenyl)-N-[ethoxycarbonyl(prop-2-enyl)amino]carbonimidoyl]phenyl] methanesulfonate (PubChem CID 54559039) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is [4-[C-(4-chlorophenyl)-N-[ethoxycarbonyl(prop-2-enyl)amino]carbonimidoyl]phenyl] methanesulfonate.
| Compound Name | [4-[C-(4-chlorophenyl)-N-[ethoxycarbonyl(prop-2-enyl)amino]carbonimidoyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 54559039 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [4-[C-(4-chlorophenyl)-N-[ethoxycarbonyl(prop-2-enyl)amino]carbonimidoyl]phenyl] methanesulfonate |
| SMILES | C=CCN(N=C(c1ccc(Cl)cc1)c1ccc(OS(C)(=O)=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C20H21ClN2O5S/c1-4-14-23(20(24)27-5-2)22-19(15-6-10-17(21)11-7-15)16-8-12-18(13-9-16)28-29(3,25)26/h4,6-13H,1,5,14H2,2-3H3 |
| InChIKey | ZPFNQOCYHSUVFV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|