C20H18ClNO2 — CID 112811410
2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide (PubChem CID 112811410) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 112811410 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO2/c1-3-13-22(14-4-2)20(24)18-8-6-5-7-17(18)19(23)15-9-11-16(21)12-10-15/h3-12H,1-2,13-14H2 |
| InChIKey | BQZSBDXEHURKQP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|