About 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide
2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide (PubChem CID 112811410) has the molecular formula C20H18ClNO2
and a molecular weight of 339.82 g/mol. Its IUPAC name is 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide.
Molecular Properties
| Compound Name | 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide |
| PubChem CID | 112811410 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO2/c1-3-13-22(14-4-2)20(24)18-8-6-5-7-17(18)19(23)15-9-11-16(21)12-10-15/h3-12H,1-2,13-14H2 |
| InChIKey | BQZSBDXEHURKQP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide?
The IUPAC name of 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide (CID 112811410) is 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide.
What is the SMILES notation for 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide?
The canonical SMILES for 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide is C=CCN(CC=C)C(=O)c1ccccc1C(=O)c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide?
The InChIKey is BQZSBDXEHURKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClNO2/c1-3-13-22(14-4-2)20(24)18-8-6-5-7-17(18)19(23)15-9-11-16(21)12-10-15/h3-12H,1-2,13-14H2.
What are the key properties of 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide?
2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide has a molecular weight of 339.82 g/mol, XLogP of 4.39, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorobenzoyl)-N,N-bis(prop-2-enyl)benzamide is sourced from PubChem (CID 112811410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).