C23H23ClN2O — CID 42763848
4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 42763848) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is 4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42763848 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1cccn1Cc1ccccc1C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O/c1-3-14-26(23(27)19-10-12-21(24)13-11-19)17-22-9-6-15-25(22)16-20-8-5-4-7-18(20)2/h3-13,15H,1,14,16-17H2,2H3 |
| InChIKey | VVSJMSGVJHJPSY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|