C21H28N2O — CID 42763891
3-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbutanamide (PubChem CID 42763891) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbutanamide.
| Compound Name | 3-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 42763891 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-methyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylbutanamide |
| SMILES | C=CCN(Cc1cccn1Cc1ccccc1C)C(=O)CC(C)C |
| InChI | InChI=1S/C21H28N2O/c1-5-12-23(21(24)14-17(2)3)16-20-11-8-13-22(20)15-19-10-7-6-9-18(19)4/h5-11,13,17H,1,12,14-16H2,2-4H3 |
| InChIKey | GVRGBSXPNMKCJN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|