C24H26ClN3O — CID 3694254
3-(3-chloro-4-methylphenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea (PubChem CID 3694254) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 3694254 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1cccn1Cc1ccccc1C)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C24H26ClN3O/c1-4-13-28(24(29)26-21-12-11-19(3)23(25)15-21)17-22-10-7-14-27(22)16-20-9-6-5-8-18(20)2/h4-12,14-15H,1,13,16-17H2,2-3H3,(H,26,29) |
| InChIKey | VXRNPKOBCDYAFD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|