C25H30ClN3O — CID 5023258
3-(4-chlorophenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea (PubChem CID 5023258) has the molecular formula C25H30ClN3O and a molecular weight of 423.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea.
| Compound Name | 3-(4-chlorophenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea |
|---|---|
| PubChem CID | 5023258 |
| Molecular Formula | C25H30ClN3O |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-1-pentylurea |
| SMILES | CCCCCN(Cc1cccn1Cc1ccccc1C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClN3O/c1-3-4-7-16-29(25(30)27-23-14-12-22(26)13-15-23)19-24-11-8-17-28(24)18-21-10-6-5-9-20(21)2/h5-6,8-15,17H,3-4,7,16,18-19H2,1-2H3,(H,27,30) |
| InChIKey | IJLOLYQRESPXDR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|