C24H28BrN3O — CID 4574835
3-(4-bromophenyl)-1-butyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]urea (PubChem CID 4574835) has the molecular formula C24H28BrN3O and a molecular weight of 454.41 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-butyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]urea.
| Compound Name | 3-(4-bromophenyl)-1-butyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 4574835 |
| Molecular Formula | C24H28BrN3O |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 3-(4-bromophenyl)-1-butyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]urea |
| SMILES | CCCCN(Cc1cccn1Cc1ccccc1C)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H28BrN3O/c1-3-4-15-28(24(29)26-22-13-11-21(25)12-14-22)18-23-10-7-16-27(23)17-20-9-6-5-8-19(20)2/h5-14,16H,3-4,15,17-18H2,1-2H3,(H,26,29) |
| InChIKey | VSRLZSDYCYLFTO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |