C25H27F3N2O — CID 3942551
N-butyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 3942551) has the molecular formula C25H27F3N2O and a molecular weight of 428.50 g/mol. Its IUPAC name is N-butyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-butyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3942551 |
| Molecular Formula | C25H27F3N2O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-butyl-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCCCN(Cc1cccn1Cc1ccccc1C)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H27F3N2O/c1-3-4-15-30(24(31)20-11-13-22(14-12-20)25(26,27)28)18-23-10-7-16-29(23)17-21-9-6-5-8-19(21)2/h5-14,16H,3-4,15,17-18H2,1-2H3 |
| InChIKey | NKCDHHKSRHVUBY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |