C34H47N3O3 — CID 42777917
N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-butylbenzamide (PubChem CID 42777917) has the molecular formula C34H47N3O3 and a molecular weight of 545.77 g/mol. Its IUPAC name is N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-butylbenzamide.
| Compound Name | N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-butylbenzamide |
|---|---|
| PubChem CID | 42777917 |
| Molecular Formula | C34H47N3O3 |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.36 |
| IUPAC Name | N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-butylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCCC)CC(=O)N(Cc2cccn2Cc2ccccc2C)C(C)CC)cc1 |
| InChI | InChI=1S/C34H47N3O3/c1-6-9-21-36(34(39)29-17-19-32(20-18-29)40-23-10-7-2)26-33(38)37(28(5)8-3)25-31-16-13-22-35(31)24-30-15-12-11-14-27(30)4/h11-20,22,28H,6-10,21,23-26H2,1-5H3 |
| InChIKey | VGEYCFBKVWKCOR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|