C33H45N3O3 — CID 42777045
N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-propylbenzamide (PubChem CID 42777045) has the molecular formula C33H45N3O3 and a molecular weight of 531.74 g/mol. Its IUPAC name is N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-propylbenzamide.
| Compound Name | N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-propylbenzamide |
|---|---|
| PubChem CID | 42777045 |
| Molecular Formula | C33H45N3O3 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | N-[2-[butan-2-yl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-butoxy-N-propylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCC)CC(=O)N(Cc2cccn2Cc2ccccc2C)C(C)CC)cc1 |
| InChI | InChI=1S/C33H45N3O3/c1-6-9-22-39-31-18-16-28(17-19-31)33(38)35(20-7-2)25-32(37)36(27(5)8-3)24-30-15-12-21-34(30)23-29-14-11-10-13-26(29)4/h10-19,21,27H,6-9,20,22-25H2,1-5H3 |
| InChIKey | LPCUCFWVDJHSNO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|