C23H26ClN3O2 — CID 3946725
1-[(1-benzylpyrrol-2-yl)methyl]-3-(3-chloro-4-methylphenyl)-1-(2-methoxyethyl)urea (PubChem CID 3946725) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-[(1-benzylpyrrol-2-yl)methyl]-3-(3-chloro-4-methylphenyl)-1-(2-methoxyethyl)urea.
| Compound Name | 1-[(1-benzylpyrrol-2-yl)methyl]-3-(3-chloro-4-methylphenyl)-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 3946725 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[(1-benzylpyrrol-2-yl)methyl]-3-(3-chloro-4-methylphenyl)-1-(2-methoxyethyl)urea |
| SMILES | COCCN(Cc1cccn1Cc1ccccc1)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClN3O2/c1-18-10-11-20(15-22(18)24)25-23(28)27(13-14-29-2)17-21-9-6-12-26(21)16-19-7-4-3-5-8-19/h3-12,15H,13-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | OWXAPYVOYGLOCA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |